C26H25F3N2O5S — CID 174546627
[1-(1-acetyl-2,3-dihydroindol-5-yl)prop-2-enylsulfonyl-[5-(trifluoromethyl)-1H-indol-2-yl]methyl] propanoate (PubChem CID 174546627) has the molecular formula C26H25F3N2O5S and a molecular weight of 534.56 g/mol. Its IUPAC name is [1-(1-acetyl-2,3-dihydroindol-5-yl)prop-2-enylsulfonyl-[5-(trifluoromethyl)-1H-indol-2-yl]methyl] propanoate.
| Compound Name | [1-(1-acetyl-2,3-dihydroindol-5-yl)prop-2-enylsulfonyl-[5-(trifluoromethyl)-1H-indol-2-yl]methyl] propanoate |
|---|---|
| PubChem CID | 174546627 |
| Molecular Formula | C26H25F3N2O5S |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | [1-(1-acetyl-2,3-dihydroindol-5-yl)prop-2-enylsulfonyl-[5-(trifluoromethyl)-1H-indol-2-yl]methyl] propanoate |
| SMILES | C=CC(c1ccc2c(c1)CCN2C(C)=O)S(=O)(=O)C(OC(=O)CC)c1cc2cc(C(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C26H25F3N2O5S/c1-4-23(17-6-9-22-16(12-17)10-11-31(22)15(3)32)37(34,35)25(36-24(33)5-2)21-14-18-13-19(26(27,28)29)7-8-20(18)30-21/h4,6-9,12-14,23,25,30H,1,5,10-11H2,2-3H3 |
| InChIKey | QULOIFFAUOSSFF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|