C17H22F4N4O — CID 174546753
2,4-bis[2-(difluoromethyl)-3-ethylimidazol-4-yl]pentan-3-one (PubChem CID 174546753) has the molecular formula C17H22F4N4O and a molecular weight of 374.38 g/mol. Its IUPAC name is 2,4-bis[2-(difluoromethyl)-3-ethylimidazol-4-yl]pentan-3-one.
| Compound Name | 2,4-bis[2-(difluoromethyl)-3-ethylimidazol-4-yl]pentan-3-one |
|---|---|
| PubChem CID | 174546753 |
| Molecular Formula | C17H22F4N4O |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2,4-bis[2-(difluoromethyl)-3-ethylimidazol-4-yl]pentan-3-one |
| SMILES | CCn1c(C(C)C(=O)C(C)c2cnc(C(F)F)n2CC)cnc1C(F)F |
| InChI | InChI=1S/C17H22F4N4O/c1-5-24-11(7-22-16(24)14(18)19)9(3)13(26)10(4)12-8-23-17(15(20)21)25(12)6-2/h7-10,14-15H,5-6H2,1-4H3 |
| InChIKey | VWVSZGJKSPCUHO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |