C30H26F3N — CID 174546788
1H-3-benzazepine;1-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydrochrysene (PubChem CID 174546788) has the molecular formula C30H26F3N and a molecular weight of 457.54 g/mol. Its IUPAC name is 1H-3-benzazepine;1-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydrochrysene.
| Compound Name | 1H-3-benzazepine;1-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174546788 |
| Molecular Formula | C30H26F3N |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1H-3-benzazepine;1-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydrochrysene |
| SMILES | C1=Cc2ccccc2CC=N1.CC1=c2ccc3c(c2CCC1)CC=c1cc(C(F)(F)F)ccc1=3 |
| InChI | InChI=1S/C20H17F3.C10H9N/c1-12-3-2-4-17-15(12)9-10-18-16-8-6-14(20(21,22)23)11-13(16)5-7-19(17)18;1-2-4-10-6-8-11-7-5-9(10)3-1/h5-6,8-11H,2-4,7H2,1H3;1-5,7-8H,6H2 |
| InChIKey | FRBCRJURUSYCJA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |