About 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid
6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid (PubChem CID 174546854) has the molecular formula C23H24ClN3O5S
and a molecular weight of 489.98 g/mol. Its IUPAC name is 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid.
Molecular Properties
| Compound Name | 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid |
| PubChem CID | 174546854 |
| Molecular Formula | C23H24ClN3O5S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid |
| SMILES | CCC(C)C(=O)O.Nc1nc2ccc(C=CCS(=O)(=O)n3ccc4cc(Cl)ccc43)cc2o1 |
| InChI | InChI=1S/C18H14ClN3O3S.C5H10O2/c19-14-4-6-16-13(11-14)7-8-22(16)26(23,24)9-1-2-12-3-5-15-17(10-12)25-18(20)21-15;1-3-4(2)5(6)7/h1-8,10-11H,9H2,(H2,20,21);4H,3H2,1-2H3,(H,6,7) |
| InChIKey | BKCSEMAHMKUSPO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid?
The IUPAC name of 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid (CID 174546854) is 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid.
What is the SMILES notation for 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid?
The canonical SMILES for 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid is CCC(C)C(=O)O.Nc1nc2ccc(C=CCS(=O)(=O)n3ccc4cc(Cl)ccc43)cc2o1.
What is the InChIKey of 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid?
The InChIKey is BKCSEMAHMKUSPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3O3S.C5H10O2/c19-14-4-6-16-13(11-14)7-8-22(16)26(23,24)9-1-2-12-3-5-15-17(10-12)25-18(20)21-15;1-3-4(2)5(6)7/h1-8,10-11H,9H2,(H2,20,21);4H,3H2,1-2H3,(H,6,7).
What are the key properties of 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid?
6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid has a molecular weight of 489.98 g/mol, XLogP of 5.03, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(5-chloroindol-1-yl)sulfonylprop-1-enyl]-1,3-benzoxazol-2-amine;2-methylbutanoic acid is sourced from PubChem (CID 174546854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).