C22H23BrO — CID 174546861
8-bromo-1-methyl-7-propan-2-yloxy-2,3,4,5-tetrahydrochrysene (PubChem CID 174546861) has the molecular formula C22H23BrO and a molecular weight of 383.33 g/mol. Its IUPAC name is 8-bromo-1-methyl-7-propan-2-yloxy-2,3,4,5-tetrahydrochrysene.
| Compound Name | 8-bromo-1-methyl-7-propan-2-yloxy-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174546861 |
| Molecular Formula | C22H23BrO |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 8-bromo-1-methyl-7-propan-2-yloxy-2,3,4,5-tetrahydrochrysene |
| SMILES | CC1=c2ccc3c(c2CCC1)CC=c1c(OC(C)C)c(Br)ccc1=3 |
| InChI | InChI=1S/C22H23BrO/c1-13(2)24-22-20-10-9-17-16-6-4-5-14(3)15(16)7-8-18(17)19(20)11-12-21(22)23/h7-8,10-13H,4-6,9H2,1-3H3 |
| InChIKey | OBQZZJRLYNSWAM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |