C20H19Cl — CID 174546947
8-chloro-1-ethyl-2,3,4,5-tetrahydrochrysene (PubChem CID 174546947) has the molecular formula C20H19Cl and a molecular weight of 294.82 g/mol. Its IUPAC name is 8-chloro-1-ethyl-2,3,4,5-tetrahydrochrysene.
| Compound Name | 8-chloro-1-ethyl-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174546947 |
| Molecular Formula | C20H19Cl |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 8-chloro-1-ethyl-2,3,4,5-tetrahydrochrysene |
| SMILES | CCC1=c2ccc3c(c2CCC1)CC=c1cc(Cl)ccc1=3 |
| InChI | InChI=1S/C20H19Cl/c1-2-13-4-3-5-18-16(13)10-11-19-17-9-7-15(21)12-14(17)6-8-20(18)19/h6-7,9-12H,2-5,8H2,1H3 |
| InChIKey | USZDQSIHSFWVAT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |