About 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine
2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine (PubChem CID 174547053) has the molecular formula C11H9F3N2
and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine |
| PubChem CID | 174547053 |
| Molecular Formula | C11H9F3N2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine |
| SMILES | FC(F)C(F)C1C=NC=c2ccccc2=N1 |
| InChI | InChI=1S/C11H9F3N2/c12-10(11(13)14)9-6-15-5-7-3-1-2-4-8(7)16-9/h1-6,9-11H |
| InChIKey | ILSQOAOFUNCICT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine?
The IUPAC name of 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine (CID 174547053) is 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine.
What is the SMILES notation for 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine?
The canonical SMILES for 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine is FC(F)C(F)C1C=NC=c2ccccc2=N1.
What is the InChIKey of 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine?
The InChIKey is ILSQOAOFUNCICT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2/c12-10(11(13)14)9-6-15-5-7-3-1-2-4-8(7)16-9/h1-6,9-11H.
What are the key properties of 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine?
2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine has a molecular weight of 226.20 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,2-trifluoroethyl)-2H-1,4-benzodiazepine is sourced from PubChem (CID 174547053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).