C16H9ClN4O2 — CID 17454717
(5-chloro-2-hydroxyphenyl)-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)methanone (PubChem CID 17454717) has the molecular formula C16H9ClN4O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is (5-chloro-2-hydroxyphenyl)-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)methanone.
| Compound Name | (5-chloro-2-hydroxyphenyl)-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)methanone |
|---|---|
| PubChem CID | 17454717 |
| Molecular Formula | C16H9ClN4O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (5-chloro-2-hydroxyphenyl)-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)methanone |
| SMILES | O=C(c1cnc2c3cccnc3nn2c1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H9ClN4O2/c17-10-3-4-13(22)12(6-10)14(23)9-7-19-16-11-2-1-5-18-15(11)20-21(16)8-9/h1-8,22H |
| InChIKey | WOPFVNAWLUSVJV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |