C20H27N5O4S2 — CID 174547288
N-[4-methyl-5-[5-[3-(2-morpholin-4-ylethylamino)prop-2-enylsulfonyl]-3-pyridinyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 174547288) has the molecular formula C20H27N5O4S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[4-methyl-5-[5-[3-(2-morpholin-4-ylethylamino)prop-2-enylsulfonyl]-3-pyridinyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-methyl-5-[5-[3-(2-morpholin-4-ylethylamino)prop-2-enylsulfonyl]-3-pyridinyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 174547288 |
| Molecular Formula | C20H27N5O4S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[4-methyl-5-[5-[3-(2-morpholin-4-ylethylamino)prop-2-enylsulfonyl]-3-pyridinyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2cncc(S(=O)(=O)CC=CNCCN3CCOCC3)c2)s1 |
| InChI | InChI=1S/C20H27N5O4S2/c1-15-19(30-20(23-15)24-16(2)26)17-12-18(14-22-13-17)31(27,28)11-3-4-21-5-6-25-7-9-29-10-8-25/h3-4,12-14,21H,5-11H2,1-2H3,(H,23,24,26) |
| InChIKey | FUXSXAFBTCQNLO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|