About lithium;carbanide;pentyl prop-2-ene-1-sulfonate
lithium;carbanide;pentyl prop-2-ene-1-sulfonate (PubChem CID 174547804) has the molecular formula C9H19LiO3S
and a molecular weight of 214.26 g/mol. Its IUPAC name is lithium;carbanide;pentyl prop-2-ene-1-sulfonate.
Molecular Properties
| Compound Name | lithium;carbanide;pentyl prop-2-ene-1-sulfonate |
| PubChem CID | 174547804 |
| Molecular Formula | C9H19LiO3S |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | lithium;carbanide;pentyl prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)OCCCCC.[CH3-].[Li+] |
| InChI | InChI=1S/C8H16O3S.CH3.Li/c1-3-5-6-7-11-12(9,10)8-4-2;;/h4H,2-3,5-8H2,1H3;1H3;/q;-1;+1 |
| InChIKey | BPWSKXQDQYMNQQ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;carbanide;pentyl prop-2-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;carbanide;pentyl prop-2-ene-1-sulfonate?
The IUPAC name of lithium;carbanide;pentyl prop-2-ene-1-sulfonate (CID 174547804) is lithium;carbanide;pentyl prop-2-ene-1-sulfonate.
What is the SMILES notation for lithium;carbanide;pentyl prop-2-ene-1-sulfonate?
The canonical SMILES for lithium;carbanide;pentyl prop-2-ene-1-sulfonate is C=CCS(=O)(=O)OCCCCC.[CH3-].[Li+].
What is the InChIKey of lithium;carbanide;pentyl prop-2-ene-1-sulfonate?
The InChIKey is BPWSKXQDQYMNQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3S.CH3.Li/c1-3-5-6-7-11-12(9,10)8-4-2;;/h4H,2-3,5-8H2,1H3;1H3;/q;-1;+1.
What are the key properties of lithium;carbanide;pentyl prop-2-ene-1-sulfonate?
lithium;carbanide;pentyl prop-2-ene-1-sulfonate has a molecular weight of 214.26 g/mol, XLogP of -0.84, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;carbanide;pentyl prop-2-ene-1-sulfonate is sourced from PubChem (CID 174547804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).