About hydron;pyrrolo[2,3-d]pyrimidin-4-one
hydron;pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 174548085) has the molecular formula C6H4N3O+
and a molecular weight of 134.12 g/mol. Its IUPAC name is hydron;pyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | hydron;pyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 174548085 |
| Molecular Formula | C6H4N3O+ |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | hydron;pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C1N=CN=C2N=CC=C12.[H+] |
| InChI | InChI=1S/C6H3N3O/c10-6-4-1-2-7-5(4)8-3-9-6/h1-3H/p+1 |
| InChIKey | JJJQHTCJNMSSJV-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;pyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;pyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of hydron;pyrrolo[2,3-d]pyrimidin-4-one (CID 174548085) is hydron;pyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for hydron;pyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for hydron;pyrrolo[2,3-d]pyrimidin-4-one is O=C1N=CN=C2N=CC=C12.[H+].
What is the InChIKey of hydron;pyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is JJJQHTCJNMSSJV-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H3N3O/c10-6-4-1-2-7-5(4)8-3-9-6/h1-3H/p+1.
What are the key properties of hydron;pyrrolo[2,3-d]pyrimidin-4-one?
hydron;pyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 134.12 g/mol, XLogP of 0.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;pyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 174548085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).