C34H26ClNO4S — CID 174548112
1-(3-chlorophenyl)sulfonyl-1,2,3,4-tetrahydrochrysene;quinoline-7-carboxylic acid (PubChem CID 174548112) has the molecular formula C34H26ClNO4S and a molecular weight of 580.11 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-1,2,3,4-tetrahydrochrysene;quinoline-7-carboxylic acid.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-1,2,3,4-tetrahydrochrysene;quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 174548112 |
| Molecular Formula | C34H26ClNO4S |
| Molecular Weight | 580.11 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-1,2,3,4-tetrahydrochrysene;quinoline-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2cccnc2c1.O=S(=O)(c1cccc(Cl)c1)C1CCCc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C24H19ClO2S.C10H7NO2/c25-17-6-3-7-18(15-17)28(26,27)24-10-4-9-20-22-12-11-16-5-1-2-8-19(16)21(22)13-14-23(20)24;12-10(13)8-4-3-7-2-1-5-11-9(7)6-8/h1-3,5-8,11-15,24H,4,9-10H2;1-6H,(H,12,13) |
| InChIKey | CTXSQYCIXTVXNX-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.11 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|