About trifluoromethyl pyrrolidine-2-sulfonate
trifluoromethyl pyrrolidine-2-sulfonate (PubChem CID 174548174) has the molecular formula C5H8F3NO3S
and a molecular weight of 219.18 g/mol. Its IUPAC name is trifluoromethyl pyrrolidine-2-sulfonate.
Molecular Properties
| Compound Name | trifluoromethyl pyrrolidine-2-sulfonate |
| PubChem CID | 174548174 |
| Molecular Formula | C5H8F3NO3S |
| Molecular Weight | 219.18 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | trifluoromethyl pyrrolidine-2-sulfonate |
| SMILES | O=S(=O)(OC(F)(F)F)C1CCCN1 |
| InChI | InChI=1S/C5H8F3NO3S/c6-5(7,8)12-13(10,11)4-2-1-3-9-4/h4,9H,1-3H2 |
| InChIKey | WQHOVOVODAXNNZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethyl pyrrolidine-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethyl pyrrolidine-2-sulfonate?
The IUPAC name of trifluoromethyl pyrrolidine-2-sulfonate (CID 174548174) is trifluoromethyl pyrrolidine-2-sulfonate.
What is the SMILES notation for trifluoromethyl pyrrolidine-2-sulfonate?
The canonical SMILES for trifluoromethyl pyrrolidine-2-sulfonate is O=S(=O)(OC(F)(F)F)C1CCCN1.
What is the InChIKey of trifluoromethyl pyrrolidine-2-sulfonate?
The InChIKey is WQHOVOVODAXNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3NO3S/c6-5(7,8)12-13(10,11)4-2-1-3-9-4/h4,9H,1-3H2.
What are the key properties of trifluoromethyl pyrrolidine-2-sulfonate?
trifluoromethyl pyrrolidine-2-sulfonate has a molecular weight of 219.18 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethyl pyrrolidine-2-sulfonate is sourced from PubChem (CID 174548174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).