About ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene
ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene (PubChem CID 174548218) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene.
Molecular Properties
| Compound Name | ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene |
| PubChem CID | 174548218 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene |
| SMILES | CCO.Cc1ccccc1N(C)N/N=N/c1ccccc1 |
| InChI | InChI=1S/C14H16N4.C2H6O/c1-12-8-6-7-11-14(12)18(2)17-16-15-13-9-4-3-5-10-13;1-2-3/h3-11H,1-2H3,(H,15,17);3H,2H2,1H3 |
| InChIKey | OWPCXWBJSZSIFG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene?
The IUPAC name of ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene (CID 174548218) is ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene.
What is the SMILES notation for ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene?
The canonical SMILES for ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene is CCO.Cc1ccccc1N(C)N/N=N/c1ccccc1.
What is the InChIKey of ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene?
The InChIKey is OWPCXWBJSZSIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4.C2H6O/c1-12-8-6-7-11-14(12)18(2)17-16-15-13-9-4-3-5-10-13;1-2-3/h3-11H,1-2H3,(H,15,17);3H,2H2,1H3.
What are the key properties of ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene?
ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene has a molecular weight of 286.38 g/mol, XLogP of 3.63, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-methyl-2-[methyl-(2-phenyliminohydrazinyl)amino]benzene is sourced from PubChem (CID 174548218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).