About 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole
4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole (PubChem CID 17454833) has the molecular formula C14H11N5S3
and a molecular weight of 345.48 g/mol. Its IUPAC name is 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole |
| PubChem CID | 17454833 |
| Molecular Formula | C14H11N5S3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole |
| SMILES | Cn1ncc2c(SCc3csc(-c4cccs4)n3)ncnc21 |
| InChI | InChI=1S/C14H11N5S3/c1-19-12-10(5-17-19)13(16-8-15-12)21-6-9-7-22-14(18-9)11-3-2-4-20-11/h2-5,7-8H,6H2,1H3 |
| InChIKey | RWAFYPOWWFBSBM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole?
The IUPAC name of 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole (CID 17454833) is 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole.
What is the SMILES notation for 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole?
The canonical SMILES for 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole is Cn1ncc2c(SCc3csc(-c4cccs4)n3)ncnc21.
What is the InChIKey of 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole?
The InChIKey is RWAFYPOWWFBSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5S3/c1-19-12-10(5-17-19)13(16-8-15-12)21-6-9-7-22-14(18-9)11-3-2-4-20-11/h2-5,7-8H,6H2,1H3.
What are the key properties of 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole?
4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole has a molecular weight of 345.48 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylmethyl]-2-thiophen-2-yl-1,3-thiazole is sourced from PubChem (CID 17454833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).