C20H14N4O — CID 174548407
N-[[4-(3H-imidazo[4,5-c]pyridin-2-yl)-9H-fluoren-9-yl]methylidene]hydroxylamine (PubChem CID 174548407) has the molecular formula C20H14N4O and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[[4-(3H-imidazo[4,5-c]pyridin-2-yl)-9H-fluoren-9-yl]methylidene]hydroxylamine.
| Compound Name | N-[[4-(3H-imidazo[4,5-c]pyridin-2-yl)-9H-fluoren-9-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 174548407 |
| Molecular Formula | C20H14N4O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[[4-(3H-imidazo[4,5-c]pyridin-2-yl)-9H-fluoren-9-yl]methylidene]hydroxylamine |
| SMILES | ON=CC1c2ccccc2-c2c(-c3nc4ccncc4[nH]3)cccc21 |
| InChI | InChI=1S/C20H14N4O/c25-22-10-16-12-4-1-2-5-13(12)19-14(16)6-3-7-15(19)20-23-17-8-9-21-11-18(17)24-20/h1-11,16,25H,(H,23,24) |
| InChIKey | LEOFJTORYXVJOS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|