C55H62Cl2F2N8O3 — CID 174548474
1,5-bis[6-chloro-3-[4-(2-fluorophenyl)piperidine-1-carbonyl]indol-1-yl]-2,4-bis(4-methylpiperazin-1-yl)pentan-3-one (PubChem CID 174548474) has the molecular formula C55H62Cl2F2N8O3 and a molecular weight of 992.06 g/mol. Its IUPAC name is 1,5-bis[6-chloro-3-[4-(2-fluorophenyl)piperidine-1-carbonyl]indol-1-yl]-2,4-bis(4-methylpiperazin-1-yl)pentan-3-one.
| Compound Name | 1,5-bis[6-chloro-3-[4-(2-fluorophenyl)piperidine-1-carbonyl]indol-1-yl]-2,4-bis(4-methylpiperazin-1-yl)pentan-3-one |
|---|---|
| PubChem CID | 174548474 |
| Molecular Formula | C55H62Cl2F2N8O3 |
| Molecular Weight | 992.06 g/mol |
| Exact Mass | 990.43 |
| IUPAC Name | 1,5-bis[6-chloro-3-[4-(2-fluorophenyl)piperidine-1-carbonyl]indol-1-yl]-2,4-bis(4-methylpiperazin-1-yl)pentan-3-one |
| SMILES | CN1CCN(C(Cn2cc(C(=O)N3CCC(c4ccccc4F)CC3)c3ccc(Cl)cc32)C(=O)C(Cn2cc(C(=O)N3CCC(c4ccccc4F)CC3)c3ccc(Cl)cc32)N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C55H62Cl2F2N8O3/c1-60-23-27-62(28-24-60)51(35-66-33-45(43-13-11-39(56)31-49(43)66)54(69)64-19-15-37(16-20-64)41-7-3-5-9-47(41)58)53(68)52(63-29-25-61(2)26-30-63)36-67-34-46(44-14-12-40(57)32-50(44)67)55(70)65-21-17-38(18-22-65)42-8-4-6-10-48(42)59/h3-14,31-34,37-38,51-52H,15-30,35-36H2,1-2H3 |
| InChIKey | DFMOBUHSDGBWET-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 80.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 992.06 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |