C33H36N6O2 — CID 174549019
2-butyl-N-[3-[6-[3-[[cyanomethyl(methyl)amino]methyl]anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide (PubChem CID 174549019) has the molecular formula C33H36N6O2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-butyl-N-[3-[6-[3-[[cyanomethyl(methyl)amino]methyl]anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide.
| Compound Name | 2-butyl-N-[3-[6-[3-[[cyanomethyl(methyl)amino]methyl]anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 174549019 |
| Molecular Formula | C33H36N6O2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 2-butyl-N-[3-[6-[3-[[cyanomethyl(methyl)amino]methyl]anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide |
| SMILES | CCCCc1ccccc1C(=O)Nc1cccc(-c2cn(C)c(=O)c(Nc3cccc(CN(C)CC#N)c3)n2)c1C |
| InChI | InChI=1S/C33H36N6O2/c1-5-6-12-25-13-7-8-15-28(25)32(40)37-29-17-10-16-27(23(29)2)30-22-39(4)33(41)31(36-30)35-26-14-9-11-24(20-26)21-38(3)19-18-34/h7-11,13-17,20,22H,5-6,12,19,21H2,1-4H3,(H,35,36)(H,37,40) |
| InChIKey | NKDMAIOOVDHRRL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|