About 5H-indole-4-carbaldehyde
5H-indole-4-carbaldehyde (PubChem CID 174549053) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 5H-indole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5H-indole-4-carbaldehyde |
| PubChem CID | 174549053 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 5H-indole-4-carbaldehyde |
| SMILES | O=CC1=C2C=CN=C2C=CC1 |
| InChI | InChI=1S/C9H7NO/c11-6-7-2-1-3-9-8(7)4-5-10-9/h1,3-6H,2H2 |
| InChIKey | VPRSQUDEXUBIDR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5H-indole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-indole-4-carbaldehyde?
The IUPAC name of 5H-indole-4-carbaldehyde (CID 174549053) is 5H-indole-4-carbaldehyde.
What is the SMILES notation for 5H-indole-4-carbaldehyde?
The canonical SMILES for 5H-indole-4-carbaldehyde is O=CC1=C2C=CN=C2C=CC1.
What is the InChIKey of 5H-indole-4-carbaldehyde?
The InChIKey is VPRSQUDEXUBIDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c11-6-7-2-1-3-9-8(7)4-5-10-9/h1,3-6H,2H2.
What are the key properties of 5H-indole-4-carbaldehyde?
5H-indole-4-carbaldehyde has a molecular weight of 145.16 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-indole-4-carbaldehyde is sourced from PubChem (CID 174549053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).