C30H27NO9S — CID 174549152
(2-phenylphenyl)methyl-(1,3,6,7-tetramethoxy-9-oxoxanthen-4-yl)sulfamic acid (PubChem CID 174549152) has the molecular formula C30H27NO9S and a molecular weight of 577.61 g/mol. Its IUPAC name is (2-phenylphenyl)methyl-(1,3,6,7-tetramethoxy-9-oxoxanthen-4-yl)sulfamic acid.
| Compound Name | (2-phenylphenyl)methyl-(1,3,6,7-tetramethoxy-9-oxoxanthen-4-yl)sulfamic acid |
|---|---|
| PubChem CID | 174549152 |
| Molecular Formula | C30H27NO9S |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | (2-phenylphenyl)methyl-(1,3,6,7-tetramethoxy-9-oxoxanthen-4-yl)sulfamic acid |
| SMILES | COc1cc2oc3c(N(Cc4ccccc4-c4ccccc4)S(=O)(=O)O)c(OC)cc(OC)c3c(=O)c2cc1OC |
| InChI | InChI=1S/C30H27NO9S/c1-36-23-14-21-22(15-24(23)37-2)40-30-27(29(21)32)25(38-3)16-26(39-4)28(30)31(41(33,34)35)17-19-12-8-9-13-20(19)18-10-6-5-7-11-18/h5-16H,17H2,1-4H3,(H,33,34,35) |
| InChIKey | XIAFTNXDLKHTKM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|