About 4-iminobutan-2-yl carbamate
4-iminobutan-2-yl carbamate (PubChem CID 174549383) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 4-iminobutan-2-yl carbamate.
Molecular Properties
| Compound Name | 4-iminobutan-2-yl carbamate |
| PubChem CID | 174549383 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 4-iminobutan-2-yl carbamate |
| SMILES | [H]/N=C/CC(C)OC(N)=O |
| InChI | InChI=1S/C5H10N2O2/c1-4(2-3-6)9-5(7)8/h3-4,6H,2H2,1H3,(H2,7,8)/b6-3+ |
| InChIKey | KBMLKHARSRENQA-ZZXKWVIFSA-N |
| XLogP | 0.51 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-iminobutan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminobutan-2-yl carbamate?
The IUPAC name of 4-iminobutan-2-yl carbamate (CID 174549383) is 4-iminobutan-2-yl carbamate.
What is the SMILES notation for 4-iminobutan-2-yl carbamate?
The canonical SMILES for 4-iminobutan-2-yl carbamate is [H]/N=C/CC(C)OC(N)=O.
What is the InChIKey of 4-iminobutan-2-yl carbamate?
The InChIKey is KBMLKHARSRENQA-ZZXKWVIFSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-4(2-3-6)9-5(7)8/h3-4,6H,2H2,1H3,(H2,7,8)/b6-3+.
What are the key properties of 4-iminobutan-2-yl carbamate?
4-iminobutan-2-yl carbamate has a molecular weight of 130.15 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminobutan-2-yl carbamate is sourced from PubChem (CID 174549383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).