C15H30O3 — CID 174549782
1,2-dimethoxycyclohexane;methoxycyclohexane (PubChem CID 174549782) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is 1,2-dimethoxycyclohexane;methoxycyclohexane.
| Compound Name | 1,2-dimethoxycyclohexane;methoxycyclohexane |
|---|---|
| PubChem CID | 174549782 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 1,2-dimethoxycyclohexane;methoxycyclohexane |
| SMILES | COC1CCCCC1.COC1CCCCC1OC |
| InChI | InChI=1S/C8H16O2.C7H14O/c1-9-7-5-3-4-6-8(7)10-2;1-8-7-5-3-2-4-6-7/h7-8H,3-6H2,1-2H3;7H,2-6H2,1H3 |
| InChIKey | TXJQPAREXQVQSP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |