C20H23O5P — CID 174549917
1-(diethoxy-hydroxy-methyl-λ5-phosphanyl)anthracene-9-carboxylic acid (PubChem CID 174549917) has the molecular formula C20H23O5P and a molecular weight of 374.37 g/mol. Its IUPAC name is 1-(diethoxy-hydroxy-methyl-λ5-phosphanyl)anthracene-9-carboxylic acid.
| Compound Name | 1-(diethoxy-hydroxy-methyl-λ5-phosphanyl)anthracene-9-carboxylic acid |
|---|---|
| PubChem CID | 174549917 |
| Molecular Formula | C20H23O5P |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-(diethoxy-hydroxy-methyl-λ5-phosphanyl)anthracene-9-carboxylic acid |
| SMILES | CCOP(C)(O)(OCC)c1cccc2cc3ccccc3c(C(=O)O)c12 |
| InChI | InChI=1S/C20H23O5P/c1-4-24-26(3,23,25-5-2)17-12-8-10-15-13-14-9-6-7-11-16(14)19(18(15)17)20(21)22/h6-13,23H,4-5H2,1-3H3,(H,21,22) |
| InChIKey | VJDWSIHSMGNVPS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|