C25H32N4O5 — CID 174550106
tert-butyl N-butyl-N-[(2R)-1-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]carbamate (PubChem CID 174550106) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[(2R)-1-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[(2R)-1-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]carbamate |
|---|---|
| PubChem CID | 174550106 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | tert-butyl N-butyl-N-[(2R)-1-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]carbamate |
| SMILES | CCCCN(C(=O)OC(C)(C)C)[C@@H]1C(=O)Nc2ccccc2N1Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C25H32N4O5/c1-5-6-15-28(24(32)34-25(2,3)4)23-22(31)26-19-9-7-8-10-20(19)29(23)16-17-11-13-18(14-12-17)21(30)27-33/h7-14,23,33H,5-6,15-16H2,1-4H3,(H,26,31)(H,27,30)/t23-/m0/s1 |
| InChIKey | DQZPFUDHPWVAIL-QHCPKHFHSA-N |
| XLogP | 4.13 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|