About 3-heptyl-1,1,2-trimethoxy-2-propylsilinane
3-heptyl-1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174550111) has the molecular formula C18H38O3Si
and a molecular weight of 330.59 g/mol. Its IUPAC name is 3-heptyl-1,1,2-trimethoxy-2-propylsilinane.
Molecular Properties
| Compound Name | 3-heptyl-1,1,2-trimethoxy-2-propylsilinane |
| PubChem CID | 174550111 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 3-heptyl-1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCCCCCC1CCC[Si](OC)(OC)C1(CCC)OC |
| InChI | InChI=1S/C18H38O3Si/c1-6-8-9-10-11-13-17-14-12-16-22(20-4,21-5)18(17,19-3)15-7-2/h17H,6-16H2,1-5H3 |
| InChIKey | RQYDFTUWLVUKRU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-heptyl-1,1,2-trimethoxy-2-propylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptyl-1,1,2-trimethoxy-2-propylsilinane?
The IUPAC name of 3-heptyl-1,1,2-trimethoxy-2-propylsilinane (CID 174550111) is 3-heptyl-1,1,2-trimethoxy-2-propylsilinane.
What is the SMILES notation for 3-heptyl-1,1,2-trimethoxy-2-propylsilinane?
The canonical SMILES for 3-heptyl-1,1,2-trimethoxy-2-propylsilinane is CCCCCCCC1CCC[Si](OC)(OC)C1(CCC)OC.
What is the InChIKey of 3-heptyl-1,1,2-trimethoxy-2-propylsilinane?
The InChIKey is RQYDFTUWLVUKRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O3Si/c1-6-8-9-10-11-13-17-14-12-16-22(20-4,21-5)18(17,19-3)15-7-2/h17H,6-16H2,1-5H3.
What are the key properties of 3-heptyl-1,1,2-trimethoxy-2-propylsilinane?
3-heptyl-1,1,2-trimethoxy-2-propylsilinane has a molecular weight of 330.59 g/mol, XLogP of 5.22, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptyl-1,1,2-trimethoxy-2-propylsilinane is sourced from PubChem (CID 174550111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).