About tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate
tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 174550291) has the molecular formula C18H22ClNO3
and a molecular weight of 335.83 g/mol. Its IUPAC name is tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 174550291 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(Cl)C=CC(c2ccccc2N)=C(CO)C1 |
| InChI | InChI=1S/C18H22ClNO3/c1-17(2,3)23-16(22)18(19)9-8-13(12(10-18)11-21)14-6-4-5-7-15(14)20/h4-9,21H,10-11,20H2,1-3H3 |
| InChIKey | UWALTTUVGSWODO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate (CID 174550291) is tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate is CC(C)(C)OC(=O)C1(Cl)C=CC(c2ccccc2N)=C(CO)C1.
What is the InChIKey of tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate?
The InChIKey is UWALTTUVGSWODO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22ClNO3/c1-17(2,3)23-16(22)18(19)9-8-13(12(10-18)11-21)14-6-4-5-7-15(14)20/h4-9,21H,10-11,20H2,1-3H3.
What are the key properties of tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate?
tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate has a molecular weight of 335.83 g/mol, XLogP of 3.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2-aminophenyl)-1-chloro-5-(hydroxymethyl)cyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 174550291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).