About 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine
4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine (PubChem CID 17455097) has the molecular formula C13H8N4S2
and a molecular weight of 284.37 g/mol. Its IUPAC name is 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine |
| PubChem CID | 17455097 |
| Molecular Formula | C13H8N4S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine |
| SMILES | c1ccn2c(Sc3ncnc4sccc34)ncc2c1 |
| InChI | InChI=1S/C13H8N4S2/c1-2-5-17-9(3-1)7-14-13(17)19-12-10-4-6-18-11(10)15-8-16-12/h1-8H |
| InChIKey | BSGIAOVLVWQJOW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine?
The IUPAC name of 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine (CID 17455097) is 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine?
The canonical SMILES for 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine is c1ccn2c(Sc3ncnc4sccc34)ncc2c1.
What is the InChIKey of 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine?
The InChIKey is BSGIAOVLVWQJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4S2/c1-2-5-17-9(3-1)7-14-13(17)19-12-10-4-6-18-11(10)15-8-16-12/h1-8H.
What are the key properties of 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine?
4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine has a molecular weight of 284.37 g/mol, XLogP of 3.49, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,5-a]pyridin-3-ylsulfanylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 17455097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).