About 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde
3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde (PubChem CID 174551004) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde |
| PubChem CID | 174551004 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde |
| SMILES | Cc1cccc2c1N(C)C(C=O)O2 |
| InChI | InChI=1S/C10H11NO2/c1-7-4-3-5-8-10(7)11(2)9(6-12)13-8/h3-6,9H,1-2H3 |
| InChIKey | INWMFVRYWKFZCK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde?
The IUPAC name of 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde (CID 174551004) is 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde.
What is the SMILES notation for 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde?
The canonical SMILES for 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde is Cc1cccc2c1N(C)C(C=O)O2.
What is the InChIKey of 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde?
The InChIKey is INWMFVRYWKFZCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-7-4-3-5-8-10(7)11(2)9(6-12)13-8/h3-6,9H,1-2H3.
What are the key properties of 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde?
3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde has a molecular weight of 177.20 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2H-1,3-benzoxazole-2-carbaldehyde is sourced from PubChem (CID 174551004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).