C21H18N3O4S- — CID 174551506
[3-[[4-methyl-3-(pyridin-3-ylcarbamoyl)phenyl]carbamoyl]phenyl]methanesulfinate (PubChem CID 174551506) has the molecular formula C21H18N3O4S- and a molecular weight of 408.46 g/mol. Its IUPAC name is [3-[[4-methyl-3-(pyridin-3-ylcarbamoyl)phenyl]carbamoyl]phenyl]methanesulfinate.
| Compound Name | [3-[[4-methyl-3-(pyridin-3-ylcarbamoyl)phenyl]carbamoyl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174551506 |
| Molecular Formula | C21H18N3O4S- |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | [3-[[4-methyl-3-(pyridin-3-ylcarbamoyl)phenyl]carbamoyl]phenyl]methanesulfinate |
| SMILES | Cc1ccc(NC(=O)c2cccc(CS(=O)[O-])c2)cc1C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C21H19N3O4S/c1-14-7-8-17(11-19(14)21(26)24-18-6-3-9-22-12-18)23-20(25)16-5-2-4-15(10-16)13-29(27)28/h2-12H,13H2,1H3,(H,23,25)(H,24,26)(H,27,28)/p-1 |
| InChIKey | CMSXLXZMFUQLOZ-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|