About methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate
methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate (PubChem CID 174552607) has the molecular formula C25H28F2N2O2
and a molecular weight of 426.51 g/mol. Its IUPAC name is methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate |
| PubChem CID | 174552607 |
| Molecular Formula | C25H28F2N2O2 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate |
| SMILES | CCCCCCn1cc(-c2ccc(NCc3cc(F)cc(F)c3)cc2)cc1C(=O)OC |
| InChI | InChI=1S/C25H28F2N2O2/c1-3-4-5-6-11-29-17-20(14-24(29)25(30)31-2)19-7-9-23(10-8-19)28-16-18-12-21(26)15-22(27)13-18/h7-10,12-15,17,28H,3-6,11,16H2,1-2H3 |
| InChIKey | NNUDEWWREDZZAZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate?
The IUPAC name of methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate (CID 174552607) is methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate.
What is the SMILES notation for methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate?
The canonical SMILES for methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate is CCCCCCn1cc(-c2ccc(NCc3cc(F)cc(F)c3)cc2)cc1C(=O)OC.
What is the InChIKey of methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate?
The InChIKey is NNUDEWWREDZZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28F2N2O2/c1-3-4-5-6-11-29-17-20(14-24(29)25(30)31-2)19-7-9-23(10-8-19)28-16-18-12-21(26)15-22(27)13-18/h7-10,12-15,17,28H,3-6,11,16H2,1-2H3.
What are the key properties of methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate?
methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate has a molecular weight of 426.51 g/mol, XLogP of 6.41, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-[(3,5-difluorophenyl)methylamino]phenyl]-1-hexylpyrrole-2-carboxylate is sourced from PubChem (CID 174552607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).