About 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile
2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile (PubChem CID 174552719) has the molecular formula C8H10F3NO2S
and a molecular weight of 241.23 g/mol. Its IUPAC name is 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile |
| PubChem CID | 174552719 |
| Molecular Formula | C8H10F3NO2S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile |
| SMILES | C=CC(CCC(F)(F)F)S(=O)(=O)CC#N |
| InChI | InChI=1S/C8H10F3NO2S/c1-2-7(3-4-8(9,10)11)15(13,14)6-5-12/h2,7H,1,3-4,6H2 |
| InChIKey | PWUDLSJWHMHDNV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile?
The IUPAC name of 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile (CID 174552719) is 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile.
What is the SMILES notation for 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile?
The canonical SMILES for 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile is C=CC(CCC(F)(F)F)S(=O)(=O)CC#N.
What is the InChIKey of 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile?
The InChIKey is PWUDLSJWHMHDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3NO2S/c1-2-7(3-4-8(9,10)11)15(13,14)6-5-12/h2,7H,1,3-4,6H2.
What are the key properties of 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile?
2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile has a molecular weight of 241.23 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)acetonitrile is sourced from PubChem (CID 174552719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).