C13H20F2N2 — CID 174552848
(3R,4R)-1-(6-ethyl-1-fluorocyclohexa-2,4-dien-1-yl)-3-fluoropiperidin-4-amine (PubChem CID 174552848) has the molecular formula C13H20F2N2 and a molecular weight of 242.31 g/mol. Its IUPAC name is (3R,4R)-1-(6-ethyl-1-fluorocyclohexa-2,4-dien-1-yl)-3-fluoropiperidin-4-amine.
| Compound Name | (3R,4R)-1-(6-ethyl-1-fluorocyclohexa-2,4-dien-1-yl)-3-fluoropiperidin-4-amine |
|---|---|
| PubChem CID | 174552848 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (3R,4R)-1-(6-ethyl-1-fluorocyclohexa-2,4-dien-1-yl)-3-fluoropiperidin-4-amine |
| SMILES | CCC1C=CC=CC1(F)N1CC[C@@H](N)[C@H](F)C1 |
| InChI | InChI=1S/C13H20F2N2/c1-2-10-5-3-4-7-13(10,15)17-8-6-12(16)11(14)9-17/h3-5,7,10-12H,2,6,8-9,16H2,1H3/t10?,11-,12-,13?/m1/s1 |
| InChIKey | ACMDQGDZTUWDPN-QZQSVVMZSA-N |
| XLogP | 2.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|