C25H18N2O5 — CID 174552995
(2,3-dinitrophenyl)-(1,2,3,4-tetrahydrochrysen-5-yl)methanone (PubChem CID 174552995) has the molecular formula C25H18N2O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is (2,3-dinitrophenyl)-(1,2,3,4-tetrahydrochrysen-5-yl)methanone.
| Compound Name | (2,3-dinitrophenyl)-(1,2,3,4-tetrahydrochrysen-5-yl)methanone |
|---|---|
| PubChem CID | 174552995 |
| Molecular Formula | C25H18N2O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (2,3-dinitrophenyl)-(1,2,3,4-tetrahydrochrysen-5-yl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1[N+](=O)[O-])c1cc2ccccc2c2ccc3c(c12)CCCC3 |
| InChI | InChI=1S/C25H18N2O5/c28-25(20-10-5-11-22(26(29)30)24(20)27(31)32)21-14-16-7-2-3-8-17(16)19-13-12-15-6-1-4-9-18(15)23(19)21/h2-3,5,7-8,10-14H,1,4,6,9H2 |
| InChIKey | HLIQOQOSGTZYHA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|