About 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole
6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole (PubChem CID 174553279) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole.
Molecular Properties
| Compound Name | 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole |
| PubChem CID | 174553279 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole |
| SMILES | Cc1c2cccc1C2.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C9H9N.C8H8/c1-10-7-6-8-4-2-3-5-9(8)10;1-6-7-3-2-4-8(6)5-7/h2-7H,1H3;2-4H,5H2,1H3 |
| InChIKey | VTWGXMNTVYGDMH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole?
The IUPAC name of 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole (CID 174553279) is 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole.
What is the SMILES notation for 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole?
The canonical SMILES for 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole is Cc1c2cccc1C2.Cn1ccc2ccccc21.
What is the InChIKey of 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole?
The InChIKey is VTWGXMNTVYGDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C8H8/c1-10-7-6-8-4-2-3-5-9(8)10;1-6-7-3-2-4-8(6)5-7/h2-7H,1H3;2-4H,5H2,1H3.
What are the key properties of 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole?
6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole has a molecular weight of 235.33 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylbicyclo[3.1.1]hepta-1(6),2,4-triene;1-methylindole is sourced from PubChem (CID 174553279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).