About [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate
[(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate (PubChem CID 174553480) has the molecular formula C12H12O5
and a molecular weight of 236.22 g/mol. Its IUPAC name is [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate.
Molecular Properties
| Compound Name | [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate |
| PubChem CID | 174553480 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate |
| SMILES | CC1(C(OC=O)c2ccccc2)COC(=O)O1 |
| InChI | InChI=1S/C12H12O5/c1-12(7-15-11(14)17-12)10(16-8-13)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| InChIKey | KNSNUSQLJFDJFF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate?
The IUPAC name of [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate (CID 174553480) is [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate.
What is the SMILES notation for [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate?
The canonical SMILES for [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate is CC1(C(OC=O)c2ccccc2)COC(=O)O1.
What is the InChIKey of [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate?
The InChIKey is KNSNUSQLJFDJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O5/c1-12(7-15-11(14)17-12)10(16-8-13)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3.
What are the key properties of [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate?
[(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate has a molecular weight of 236.22 g/mol, XLogP of 1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methyl-2-oxo-1,3-dioxolan-4-yl)-phenylmethyl] formate is sourced from PubChem (CID 174553480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).