About 1,3-benzothiazole;2H-chromene;zinc
1,3-benzothiazole;2H-chromene;zinc (PubChem CID 174554899) has the molecular formula C16H13NOSZn
and a molecular weight of 332.74 g/mol. Its IUPAC name is 1,3-benzothiazole;2H-chromene;zinc.
Molecular Properties
| Compound Name | 1,3-benzothiazole;2H-chromene;zinc |
| PubChem CID | 174554899 |
| Molecular Formula | C16H13NOSZn |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 1,3-benzothiazole;2H-chromene;zinc |
| SMILES | C1=Cc2ccccc2OC1.[Zn].c1ccc2scnc2c1 |
| InChI | InChI=1S/C9H8O.C7H5NS.Zn/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-7-6(3-1)8-5-9-7;/h1-6H,7H2;1-5H; |
| InChIKey | UVAVXPKKHOHNCA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;2H-chromene;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;2H-chromene;zinc?
The IUPAC name of 1,3-benzothiazole;2H-chromene;zinc (CID 174554899) is 1,3-benzothiazole;2H-chromene;zinc.
What is the SMILES notation for 1,3-benzothiazole;2H-chromene;zinc?
The canonical SMILES for 1,3-benzothiazole;2H-chromene;zinc is C1=Cc2ccccc2OC1.[Zn].c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;2H-chromene;zinc?
The InChIKey is UVAVXPKKHOHNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C7H5NS.Zn/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-7-6(3-1)8-5-9-7;/h1-6H,7H2;1-5H;.
What are the key properties of 1,3-benzothiazole;2H-chromene;zinc?
1,3-benzothiazole;2H-chromene;zinc has a molecular weight of 332.74 g/mol, XLogP of 4.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;2H-chromene;zinc is sourced from PubChem (CID 174554899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).