About chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine
chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine (PubChem CID 174555360) has the molecular formula C10H20ClNO2S
and a molecular weight of 253.79 g/mol. Its IUPAC name is chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine.
Molecular Properties
| Compound Name | chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine |
| PubChem CID | 174555360 |
| Molecular Formula | C10H20ClNO2S |
| Molecular Weight | 253.79 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine |
| SMILES | C=CCS(=O)(=O)CC1CCNCC1.CCl |
| InChI | InChI=1S/C9H17NO2S.CH3Cl/c1-2-7-13(11,12)8-9-3-5-10-6-4-9;1-2/h2,9-10H,1,3-8H2;1H3 |
| InChIKey | DBQBSWOCXLWBJR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine?
The IUPAC name of chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine (CID 174555360) is chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine.
What is the SMILES notation for chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine?
The canonical SMILES for chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine is C=CCS(=O)(=O)CC1CCNCC1.CCl.
What is the InChIKey of chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine?
The InChIKey is DBQBSWOCXLWBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S.CH3Cl/c1-2-7-13(11,12)8-9-3-5-10-6-4-9;1-2/h2,9-10H,1,3-8H2;1H3.
What are the key properties of chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine?
chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine has a molecular weight of 253.79 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;4-(prop-2-enylsulfonylmethyl)piperidine is sourced from PubChem (CID 174555360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).