About 1,1'-biphenyl;2-chlorophenol
1,1'-biphenyl;2-chlorophenol (PubChem CID 174555563) has the molecular formula C18H15ClO
and a molecular weight of 282.77 g/mol. Its IUPAC name is 1,1'-biphenyl;2-chlorophenol.
Molecular Properties
| Compound Name | 1,1'-biphenyl;2-chlorophenol |
| PubChem CID | 174555563 |
| Molecular Formula | C18H15ClO |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 1,1'-biphenyl;2-chlorophenol |
| SMILES | Oc1ccccc1Cl.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C6H5ClO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-5-3-1-2-4-6(5)8/h1-10H;1-4,8H |
| InChIKey | DUTMKSJNORWERC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1'-biphenyl;2-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;2-chlorophenol?
The IUPAC name of 1,1'-biphenyl;2-chlorophenol (CID 174555563) is 1,1'-biphenyl;2-chlorophenol.
What is the SMILES notation for 1,1'-biphenyl;2-chlorophenol?
The canonical SMILES for 1,1'-biphenyl;2-chlorophenol is Oc1ccccc1Cl.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;2-chlorophenol?
The InChIKey is DUTMKSJNORWERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C6H5ClO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-5-3-1-2-4-6(5)8/h1-10H;1-4,8H.
What are the key properties of 1,1'-biphenyl;2-chlorophenol?
1,1'-biphenyl;2-chlorophenol has a molecular weight of 282.77 g/mol, XLogP of 5.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;2-chlorophenol is sourced from PubChem (CID 174555563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).