About tert-butyl formate;5-phenoxy-1H-pyrazole
tert-butyl formate;5-phenoxy-1H-pyrazole (PubChem CID 174556121) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl formate;5-phenoxy-1H-pyrazole.
Molecular Properties
| Compound Name | tert-butyl formate;5-phenoxy-1H-pyrazole |
| PubChem CID | 174556121 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | tert-butyl formate;5-phenoxy-1H-pyrazole |
| SMILES | CC(C)(C)OC=O.c1ccc(Oc2ccn[nH]2)cc1 |
| InChI | InChI=1S/C9H8N2O.C5H10O2/c1-2-4-8(5-3-1)12-9-6-7-10-11-9;1-5(2,3)7-4-6/h1-7H,(H,10,11);4H,1-3H3 |
| InChIKey | CEZAJHOUQXRLTE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;5-phenoxy-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;5-phenoxy-1H-pyrazole?
The IUPAC name of tert-butyl formate;5-phenoxy-1H-pyrazole (CID 174556121) is tert-butyl formate;5-phenoxy-1H-pyrazole.
What is the SMILES notation for tert-butyl formate;5-phenoxy-1H-pyrazole?
The canonical SMILES for tert-butyl formate;5-phenoxy-1H-pyrazole is CC(C)(C)OC=O.c1ccc(Oc2ccn[nH]2)cc1.
What is the InChIKey of tert-butyl formate;5-phenoxy-1H-pyrazole?
The InChIKey is CEZAJHOUQXRLTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.C5H10O2/c1-2-4-8(5-3-1)12-9-6-7-10-11-9;1-5(2,3)7-4-6/h1-7H,(H,10,11);4H,1-3H3.
What are the key properties of tert-butyl formate;5-phenoxy-1H-pyrazole?
tert-butyl formate;5-phenoxy-1H-pyrazole has a molecular weight of 262.31 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;5-phenoxy-1H-pyrazole is sourced from PubChem (CID 174556121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).