C52H98O12 — CID 174556774
bis(6-methylheptyl) hexanedioate;bis(7-methyloctyl) hexanedioate;hexanedioic acid (PubChem CID 174556774) has the molecular formula C52H98O12 and a molecular weight of 915.34 g/mol. Its IUPAC name is bis(6-methylheptyl) hexanedioate;bis(7-methyloctyl) hexanedioate;hexanedioic acid.
| Compound Name | bis(6-methylheptyl) hexanedioate;bis(7-methyloctyl) hexanedioate;hexanedioic acid |
|---|---|
| PubChem CID | 174556774 |
| Molecular Formula | C52H98O12 |
| Molecular Weight | 915.34 g/mol |
| Exact Mass | 914.71 |
| IUPAC Name | bis(6-methylheptyl) hexanedioate;bis(7-methyloctyl) hexanedioate;hexanedioic acid |
| SMILES | CC(C)CCCCCCOC(=O)CCCCC(=O)OCCCCCCC(C)C.CC(C)CCCCCOC(=O)CCCCC(=O)OCCCCCC(C)C.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C24H46O4.C22H42O4.C6H10O4/c1-21(2)15-9-5-7-13-19-27-23(25)17-11-12-18-24(26)28-20-14-8-6-10-16-22(3)4;1-19(2)13-7-5-11-17-25-21(23)15-9-10-16-22(24)26-18-12-6-8-14-20(3)4;7-5(8)3-1-2-4-6(9)10/h21-22H,5-20H2,1-4H3;19-20H,5-18H2,1-4H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | GHZVZZPMLQAIDD-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.34 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|