About [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine
[4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine (PubChem CID 174556899) has the molecular formula C16H15ClN4O2S
and a molecular weight of 362.84 g/mol. Its IUPAC name is [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine |
| PubChem CID | 174556899 |
| Molecular Formula | C16H15ClN4O2S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine |
| SMILES | NCc1ccc(C=CCS(=O)(=O)n2ccc3cnc(Cl)nc32)cc1 |
| InChI | InChI=1S/C16H15ClN4O2S/c17-16-19-11-14-7-8-21(15(14)20-16)24(22,23)9-1-2-12-3-5-13(10-18)6-4-12/h1-8,11H,9-10,18H2 |
| InChIKey | IKJYEKINJFFODX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine?
The IUPAC name of [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine (CID 174556899) is [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine.
What is the SMILES notation for [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine?
The canonical SMILES for [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine is NCc1ccc(C=CCS(=O)(=O)n2ccc3cnc(Cl)nc32)cc1.
What is the InChIKey of [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine?
The InChIKey is IKJYEKINJFFODX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN4O2S/c17-16-19-11-14-7-8-21(15(14)20-16)24(22,23)9-1-2-12-3-5-13(10-18)6-4-12/h1-8,11H,9-10,18H2.
What are the key properties of [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine?
[4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine has a molecular weight of 362.84 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)sulfonylprop-1-enyl]phenyl]methanamine is sourced from PubChem (CID 174556899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).