C24H22BrN3O4 — CID 17455733
N-benzyl-3-[2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethoxy]benzamide (PubChem CID 17455733) has the molecular formula C24H22BrN3O4 and a molecular weight of 496.36 g/mol. Its IUPAC name is N-benzyl-3-[2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethoxy]benzamide.
| Compound Name | N-benzyl-3-[2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 17455733 |
| Molecular Formula | C24H22BrN3O4 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | N-benzyl-3-[2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1cccc(C(=O)NCc2ccccc2)c1)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C24H22BrN3O4/c25-20-11-4-5-12-21(20)28-22(29)15-26-23(30)16-32-19-10-6-9-18(13-19)24(31)27-14-17-7-2-1-3-8-17/h1-13H,14-16H2,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | SECRLAXBWAJEDD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |