C21H16N6O — CID 17455756
(E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-prop-2-ynoxyphenyl)prop-2-enenitrile (PubChem CID 17455756) has the molecular formula C21H16N6O and a molecular weight of 368.40 g/mol. Its IUPAC name is (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-prop-2-ynoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-prop-2-ynoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 17455756 |
| Molecular Formula | C21H16N6O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-prop-2-ynoxyphenyl)prop-2-enenitrile |
| SMILES | C#CCOc1ccccc1/C=C(\C#N)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C21H16N6O/c1-2-12-28-18-11-7-6-8-15(18)13-16(14-22)19-25-20(23)27-21(26-19)24-17-9-4-3-5-10-17/h1,3-11,13H,12H2,(H3,23,24,25,26,27)/b16-13+ |
| InChIKey | ZDGAFVQMJDXNDE-DTQAZKPQSA-N |
| XLogP | 3.27 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|