About 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid
2,2-dimethyloxirane;2-propan-2-yloxyacetic acid (PubChem CID 174557702) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid.
Molecular Properties
| Compound Name | 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid |
| PubChem CID | 174557702 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid |
| SMILES | CC(C)OCC(=O)O.CC1(C)CO1 |
| InChI | InChI=1S/C5H10O3.C4H8O/c1-4(2)8-3-5(6)7;1-4(2)3-5-4/h4H,3H2,1-2H3,(H,6,7);3H2,1-2H3 |
| InChIKey | OOBZSGVTLCSOIQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid?
The IUPAC name of 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid (CID 174557702) is 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid.
What is the SMILES notation for 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid?
The canonical SMILES for 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid is CC(C)OCC(=O)O.CC1(C)CO1.
What is the InChIKey of 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid?
The InChIKey is OOBZSGVTLCSOIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C4H8O/c1-4(2)8-3-5(6)7;1-4(2)3-5-4/h4H,3H2,1-2H3,(H,6,7);3H2,1-2H3.
What are the key properties of 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid?
2,2-dimethyloxirane;2-propan-2-yloxyacetic acid has a molecular weight of 190.24 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxirane;2-propan-2-yloxyacetic acid is sourced from PubChem (CID 174557702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).