About 1H-benzimidazol-4-ylurea;1,1-diphenylurea
1H-benzimidazol-4-ylurea;1,1-diphenylurea (PubChem CID 174558316) has the molecular formula C21H20N6O2
and a molecular weight of 388.43 g/mol. Its IUPAC name is 1H-benzimidazol-4-ylurea;1,1-diphenylurea.
Molecular Properties
| Compound Name | 1H-benzimidazol-4-ylurea;1,1-diphenylurea |
| PubChem CID | 174558316 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1H-benzimidazol-4-ylurea;1,1-diphenylurea |
| SMILES | NC(=O)N(c1ccccc1)c1ccccc1.NC(=O)Nc1cccc2[nH]cnc12 |
| InChI | InChI=1S/C13H12N2O.C8H8N4O/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12;9-8(13)12-6-3-1-2-5-7(6)11-4-10-5/h1-10H,(H2,14,16);1-4H,(H,10,11)(H3,9,12,13) |
| InChIKey | NNNWNCGQPUXDDH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-benzimidazol-4-ylurea;1,1-diphenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-4-ylurea;1,1-diphenylurea?
The IUPAC name of 1H-benzimidazol-4-ylurea;1,1-diphenylurea (CID 174558316) is 1H-benzimidazol-4-ylurea;1,1-diphenylurea.
What is the SMILES notation for 1H-benzimidazol-4-ylurea;1,1-diphenylurea?
The canonical SMILES for 1H-benzimidazol-4-ylurea;1,1-diphenylurea is NC(=O)N(c1ccccc1)c1ccccc1.NC(=O)Nc1cccc2[nH]cnc12.
What is the InChIKey of 1H-benzimidazol-4-ylurea;1,1-diphenylurea?
The InChIKey is NNNWNCGQPUXDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O.C8H8N4O/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12;9-8(13)12-6-3-1-2-5-7(6)11-4-10-5/h1-10H,(H2,14,16);1-4H,(H,10,11)(H3,9,12,13).
What are the key properties of 1H-benzimidazol-4-ylurea;1,1-diphenylurea?
1H-benzimidazol-4-ylurea;1,1-diphenylurea has a molecular weight of 388.43 g/mol, XLogP of 3.96, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-4-ylurea;1,1-diphenylurea is sourced from PubChem (CID 174558316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).