About dimethyl-bis(prop-2-enyl)azanium;nitric acid
dimethyl-bis(prop-2-enyl)azanium;nitric acid (PubChem CID 174559362) has the molecular formula C8H17N2O3+
and a molecular weight of 189.23 g/mol. Its IUPAC name is dimethyl-bis(prop-2-enyl)azanium;nitric acid.
Molecular Properties
| Compound Name | dimethyl-bis(prop-2-enyl)azanium;nitric acid |
| PubChem CID | 174559362 |
| Molecular Formula | C8H17N2O3+ |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | dimethyl-bis(prop-2-enyl)azanium;nitric acid |
| SMILES | C=CC[N+](C)(C)CC=C.O=[N+]([O-])O |
| InChI | InChI=1S/C8H16N.HNO3/c1-5-7-9(3,4)8-6-2;2-1(3)4/h5-6H,1-2,7-8H2,3-4H3;(H,2,3,4)/q+1; |
| InChIKey | LJKQEJZKIOQIRR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(prop-2-enyl)azanium;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(prop-2-enyl)azanium;nitric acid?
The IUPAC name of dimethyl-bis(prop-2-enyl)azanium;nitric acid (CID 174559362) is dimethyl-bis(prop-2-enyl)azanium;nitric acid.
What is the SMILES notation for dimethyl-bis(prop-2-enyl)azanium;nitric acid?
The canonical SMILES for dimethyl-bis(prop-2-enyl)azanium;nitric acid is C=CC[N+](C)(C)CC=C.O=[N+]([O-])O.
What is the InChIKey of dimethyl-bis(prop-2-enyl)azanium;nitric acid?
The InChIKey is LJKQEJZKIOQIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N.HNO3/c1-5-7-9(3,4)8-6-2;2-1(3)4/h5-6H,1-2,7-8H2,3-4H3;(H,2,3,4)/q+1;.
What are the key properties of dimethyl-bis(prop-2-enyl)azanium;nitric acid?
dimethyl-bis(prop-2-enyl)azanium;nitric acid has a molecular weight of 189.23 g/mol, XLogP of 1.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(prop-2-enyl)azanium;nitric acid is sourced from PubChem (CID 174559362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).