About argon;3-methyl-2H-quinazoline
argon;3-methyl-2H-quinazoline (PubChem CID 174559439) has the molecular formula C9H10Ar11N2
and a molecular weight of 585.62 g/mol. Its IUPAC name is argon;3-methyl-2H-quinazoline.
Molecular Properties
| Compound Name | argon;3-methyl-2H-quinazoline |
| PubChem CID | 174559439 |
| Molecular Formula | C9H10Ar11N2 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.67 |
| IUPAC Name | argon;3-methyl-2H-quinazoline |
| SMILES | CN1C=c2ccccc2=NC1.[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar] |
| InChI | InChI=1S/C9H10N2.11Ar/c1-11-6-8-4-2-3-5-9(8)10-7-11;;;;;;;;;;;/h2-6H,7H2,1H3;;;;;;;;;;; |
| InChIKey | IRPKFJLTDKICQI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze argon;3-methyl-2H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;3-methyl-2H-quinazoline?
The IUPAC name of argon;3-methyl-2H-quinazoline (CID 174559439) is argon;3-methyl-2H-quinazoline.
What is the SMILES notation for argon;3-methyl-2H-quinazoline?
The canonical SMILES for argon;3-methyl-2H-quinazoline is CN1C=c2ccccc2=NC1.[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].
What is the InChIKey of argon;3-methyl-2H-quinazoline?
The InChIKey is IRPKFJLTDKICQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.11Ar/c1-11-6-8-4-2-3-5-9(8)10-7-11;;;;;;;;;;;/h2-6H,7H2,1H3;;;;;;;;;;;.
What are the key properties of argon;3-methyl-2H-quinazoline?
argon;3-methyl-2H-quinazoline has a molecular weight of 585.62 g/mol, XLogP of -0.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for argon;3-methyl-2H-quinazoline is sourced from PubChem (CID 174559439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).