C15H15BrF3NO2 — CID 174559804
4-(2-bromoethyl)-5-propan-2-yl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole (PubChem CID 174559804) has the molecular formula C15H15BrF3NO2 and a molecular weight of 378.19 g/mol. Its IUPAC name is 4-(2-bromoethyl)-5-propan-2-yl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole.
| Compound Name | 4-(2-bromoethyl)-5-propan-2-yl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 174559804 |
| Molecular Formula | C15H15BrF3NO2 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 4-(2-bromoethyl)-5-propan-2-yl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole |
| SMILES | CC(C)c1onc(-c2ccccc2OC(F)(F)F)c1CCBr |
| InChI | InChI=1S/C15H15BrF3NO2/c1-9(2)14-11(7-8-16)13(20-22-14)10-5-3-4-6-12(10)21-15(17,18)19/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | RNLUTNIJBQLDKW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|