About 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride
2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride (PubChem CID 17456) has the molecular formula C19H22Cl2N2OS
and a molecular weight of 397.37 g/mol. Its IUPAC name is 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride.
Molecular Properties
| Compound Name | 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride |
| PubChem CID | 17456 |
| Molecular Formula | C19H22Cl2N2OS |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride |
| SMILES | CC[NH+](CC)CCOc1ccc(-c2nc3cc(Cl)ccc3s2)cc1.[Cl-] |
| InChI | InChI=1S/C19H21ClN2OS.ClH/c1-3-22(4-2)11-12-23-16-8-5-14(6-9-16)19-21-17-13-15(20)7-10-18(17)24-19;/h5-10,13H,3-4,11-12H2,1-2H3;1H |
| InChIKey | ZDKBIKAYRLTVKY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 26.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride?
The IUPAC name of 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride (CID 17456) is 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride.
What is the SMILES notation for 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride?
The canonical SMILES for 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride is CC[NH+](CC)CCOc1ccc(-c2nc3cc(Cl)ccc3s2)cc1.[Cl-].
What is the InChIKey of 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride?
The InChIKey is ZDKBIKAYRLTVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2OS.ClH/c1-3-22(4-2)11-12-23-16-8-5-14(6-9-16)19-21-17-13-15(20)7-10-18(17)24-19;/h5-10,13H,3-4,11-12H2,1-2H3;1H.
What are the key properties of 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride?
2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride has a molecular weight of 397.37 g/mol, XLogP of 0.92, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]ethyl-diethylazanium chloride is sourced from PubChem (CID 17456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).