C12H9F3N2O3S — CID 174560495
[4-oxo-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]carbamic acid (PubChem CID 174560495) has the molecular formula C12H9F3N2O3S and a molecular weight of 318.28 g/mol. Its IUPAC name is [4-oxo-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]carbamic acid.
| Compound Name | [4-oxo-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]carbamic acid |
|---|---|
| PubChem CID | 174560495 |
| Molecular Formula | C12H9F3N2O3S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | [4-oxo-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]carbamic acid |
| SMILES | O=C(O)N=C1NC(=O)C(Cc2cccc(C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C12H9F3N2O3S/c13-12(14,15)7-3-1-2-6(4-7)5-8-9(18)16-10(21-8)17-11(19)20/h1-4,8H,5H2,(H,19,20)(H,16,17,18) |
| InChIKey | POGPMHINRQKVSS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|